EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O3 |
| Net Charge | -1 |
| Average Mass | 317.449 |
| Monoisotopic Mass | 317.21222 |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H]1O[C@H]1CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-19(23-18)16-14-17-20(21)22/h6-7,9-13,15,18-19H,2-5,8,14,16-17H2,1H3,(H,21,22)/p-1/b7-6-,10-9-,12-11+,15-13+/t18-,19-/m0/s1 |
| InChIKey | UFPQIRYSPUYQHK-WAQVJNLQSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leukotriene A4(1−) (CHEBI:57463) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| leukotriene A4(1−) (CHEBI:57463) has role human metabolite (CHEBI:77746) |
| leukotriene A4(1−) (CHEBI:57463) is a leukotriene anion (CHEBI:62942) |
| leukotriene A4(1−) (CHEBI:57463) is a monocarboxylic acid anion (CHEBI:35757) |
| leukotriene A4(1−) (CHEBI:57463) is conjugate base of leukotriene A4 (CHEBI:15651) |
| Incoming Relation(s) |
| leukotriene A4 (CHEBI:15651) is conjugate acid of leukotriene A4(1−) (CHEBI:57463) |
| IUPAC Name |
|---|
| (5S,6S,7E,9E,11Z,14Z)-5,6-epoxyicosa-7,9,11,14-tetraenoate |
| Synonyms | Source |
|---|---|
| (7E,9E,11Z,14Z)-(5S,6S)-5,6-epoxyicosa-7,9,11,14-tetraenoate | MetaCyc |
| leukotriene A4 anion | ChEBI |
| LTA4(1−) | ChEBI |
| LTA4 anion | ChEBI |
| UniProt Name | Source |
|---|---|
| leukotriene A4 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8892 | MetaCyc |