EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2 |
| Net Charge | 0 |
| Average Mass | 89.094 |
| Monoisotopic Mass | 89.04768 |
| SMILES | CNCC(=O)O |
| InChI | InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6) |
| InChIKey | FSYKKLYZXJSNPZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. glycine transporter 1 inhibitor Any glycine transporter inhibitor that interferes with the action of glycine 1 transporters. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). glycine receptor agonist An agonist that binds to and activates glycine receptors |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sarcosine (CHEBI:15611) has role Escherichia coli metabolite (CHEBI:76971) |
| sarcosine (CHEBI:15611) has role antidepressant (CHEBI:35469) |
| sarcosine (CHEBI:15611) has role antipsychotic agent (CHEBI:35476) |
| sarcosine (CHEBI:15611) has role glycine receptor agonist (CHEBI:64589) |
| sarcosine (CHEBI:15611) has role glycine transporter 1 inhibitor (CHEBI:64588) |
| sarcosine (CHEBI:15611) has role human metabolite (CHEBI:77746) |
| sarcosine (CHEBI:15611) has role mouse metabolite (CHEBI:75771) |
| sarcosine (CHEBI:15611) is a N-alkylglycine (CHEBI:66933) |
| sarcosine (CHEBI:15611) is a N-methyl-amino acid (CHEBI:21760) |
| sarcosine (CHEBI:15611) is a N-methylglycines (CHEBI:21766) |
| sarcosine (CHEBI:15611) is conjugate acid of sarcosinate (CHEBI:46915) |
| sarcosine (CHEBI:15611) is conjugate base of sarcosinium (CHEBI:46842) |
| sarcosine (CHEBI:15611) is tautomer of sarcosine zwitterion (CHEBI:57433) |
| Incoming Relation(s) |
| N-nitrososarcosine (CHEBI:82363) has functional parent sarcosine (CHEBI:15611) |
| sarcosinium (CHEBI:46842) is conjugate acid of sarcosine (CHEBI:15611) |
| sarcosinate (CHEBI:46915) is conjugate base of sarcosine (CHEBI:15611) |
| sarcosine zwitterion (CHEBI:57433) is tautomer of sarcosine (CHEBI:15611) |
| IUPAC Name |
|---|
| sarcosine |
| Synonyms | Source |
|---|---|
| N-methylaminoacetic acid | NIST Chemistry WebBook |
| L-sarcosine | ChEBI |
| MeGly | ChEBI |
| (methylamino)acetic acid | ChemIDplus |
| methylaminoacetic acid | NIST Chemistry WebBook |
| Methylamino-acetic acid | ChEMBL |
| Citations |
|---|