EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15F3N2O3 |
| Net Charge | 0 |
| Average Mass | 316.279 |
| Monoisotopic Mass | 316.10348 |
| SMILES | O=C(c1ccco1)N1N=C2CCCCCC2C1(O)C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O3/c15-14(16,17)13(21)9-5-2-1-3-6-10(9)18-19(13)12(20)11-7-4-8-22-11/h4,7-9,21H,1-3,5-6H2 |
| InChIKey | MLZOQSJEXLROFX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-furanyl-[3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]methanone (CHEBI:108275) is a furoic acid (CHEBI:36055) |
| Manual Xrefs | Databases |
|---|---|
| LSM-19652 | LINCS |