EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15394 - (−)-borneol
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](O)C2 |
| InChI | InChI=1S/C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8+,10+/m0/s1 |
| InChIKey | DTGKSKDOIYIVQL-QXFUBDJGSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-borneol (CHEBI:15394) is a borneol (CHEBI:28093) |
| (−)-borneol (CHEBI:15394) is enantiomer of (+)-borneol (CHEBI:15393) |
| Incoming Relation(s) |
| (−)-bornyl diphosphate (CHEBI:64298) has functional parent (−)-borneol (CHEBI:15394) |
| tschimganine (CHEBI:142517) has functional parent (−)-borneol (CHEBI:15394) |
| β-hibitakanine (CHEBI:142524) has functional parent (−)-borneol (CHEBI:15394) |
| (+)-borneol (CHEBI:15393) is enantiomer of (−)-borneol (CHEBI:15394) |
| IUPAC Name |
|---|
| (1S,2R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| Synonyms | Source |
|---|---|
| (-)-Borneol | KEGG COMPOUND |
| L-Borneol | KEGG COMPOUND |
| (1S,2R,4S)-(-)-Borneol | KEGG COMPOUND |
| (1S-endo)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol | NIST Chemistry WebBook |
| (1S,2R,4S)-(−)-borneol | NIST Chemistry WebBook |
| L-borneol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (1S,2R,4S)-borneol | UniProt |