EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19NO3 |
| Net Charge | 0 |
| Average Mass | 237.299 |
| Monoisotopic Mass | 237.13649 |
| SMILES | CCCc1oc(C(=O)O)cc1CN1CCCC1 |
| InChI | InChI=1S/C13H19NO3/c1-2-5-11-10(8-12(17-11)13(15)16)9-14-6-3-4-7-14/h8H,2-7,9H2,1H3,(H,15,16) |
| InChIKey | BEVFYPNHCDGTJQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-propyl-4-(1-pyrrolidinylmethyl)-2-furancarboxylic acid (CHEBI:104123) is a furoic acid (CHEBI:36055) |
| Manual Xrefs | Databases |
|---|---|
| LSM-15480 | LINCS |