EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N4O3S |
| Net Charge | 0 |
| Average Mass | 280.309 |
| Monoisotopic Mass | 280.06301 |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(N)cc2)nn1 |
| InChI | InChI=1S/C11H12N4O3S/c1-18-11-7-6-10(13-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) |
| InChIKey | VLYWMPOKSSWJAL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfamethoxypyridazine (CHEBI:102516) has functional parent sulfanilamide (CHEBI:45373) |
| sulfamethoxypyridazine (CHEBI:102516) has role antiinfective agent (CHEBI:35441) |
| sulfamethoxypyridazine (CHEBI:102516) has role drug allergen (CHEBI:88188) |
| sulfamethoxypyridazine (CHEBI:102516) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| sulfamethoxypyridazine (CHEBI:102516) is a pyridazines (CHEBI:37921) |
| sulfamethoxypyridazine (CHEBI:102516) is a sulfonamide (CHEBI:35358) |
| sulfamethoxypyridazine (CHEBI:102516) is a sulfonamide antibiotic (CHEBI:87228) |
| IUPAC Name |
|---|
| 4-amino-N-(6-methoxypyridazin-3-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfamethoxypyridazine | KEGG DRUG |
| sulfamethoxypyridazinum | ChemIDplus |
| sulfametoxipiridazina | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(4-Aminobenzenesulfonamido)-6-methoxypyridazine | NIST Chemistry WebBook |
| 3-Methoxy-6-sulfanylamidopyridazine | ChemIDplus |
| 3-(p-Aminobenzenesulfamido)-6-methoxypyridazine | ChemIDplus |
| 3-p-Aminobenzenesulphonamido-6-methoxypyridazine | ChemIDplus |
| 3-Sulfa-6-methoxypyridazine | ChemIDplus |
| 3-Sulfanilamide-6-methoxypyridazine | ChemIDplus |
| Citations |
|---|