EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:102216 - methohexital
| Formula | C14H18N2O3 |
| Net Charge | 0 |
| Average Mass | 262.309 |
| Monoisotopic Mass | 262.13174 |
| SMILES | C=CCC1(C(C)C#CCC)C(=O)NC(=O)N(C)C1=O |
| InChI | InChI=1S/C14H18N2O3/c1-5-7-8-10(3)14(9-6-2)11(17)15-13(19)16(4)12(14)18/h6,10H,2,5,9H2,1,3-4H3,(H,15,17,19) |
| InChIKey | NZXKDOXHBHYTKP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methohexital (CHEBI:102216) has role drug allergen (CHEBI:88188) |
| methohexital (CHEBI:102216) has role intravenous anaesthetic (CHEBI:38877) |
| methohexital (CHEBI:102216) is a acetylenic compound (CHEBI:73474) |
| methohexital (CHEBI:102216) is a barbiturates (CHEBI:22693) |
| methohexital (CHEBI:102216) is conjugate acid of methohexital(1−) (CHEBI:60792) |
| Incoming Relation(s) |
| methohexital(1−) (CHEBI:60792) is conjugate base of methohexital (CHEBI:102216) |
| IUPAC Name |
|---|
| 1-methyl-5-(1-methylpent-2-yn-1-yl)-5-(prop-2-en-1-yl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| INNs | Source |
|---|---|
| Methohexital | ChEBI |
| Methohexitalum | ChemIDplus |
| Metohexital | ChemIDplus |
| Synonyms | Source |
|---|---|
| Methohexital | KEGG COMPOUND |
| 5-Allyl-1-methyl-5-(1-methyl-pent-2-ynyl)-pyrimidine-2,4,6-trione | ChEMBL |
| Methohexitone | ChemIDplus |
| (±)-5-allyl-1-methyl-5-(1-methyl-2-pentynyl)barbituric acid | ChemIDplus |
| 5-Allyl-5-(3-hexyn-2-yl)-1-methylbarbituric acid | ChemIDplus |
| 5-allyl-1-methyl-5-(1-methyl-2-pentynyl)-2,4,6(1H,3H,5H)-pyrimidinetrione | NIST Chemistry WebBook |
| Citations |
|---|