EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N5S |
| Net Charge | 0 |
| Average Mass | 377.517 |
| Monoisotopic Mass | 377.16742 |
| SMILES | CCC(CC)[C@@H](c1ccc(Nc2nc3ccccc3s2)cc1)n1cncn1 |
| InChI | InChI=1S/C21H23N5S/c1-3-15(4-2)20(26-14-22-13-23-26)16-9-11-17(12-10-16)24-21-25-18-7-5-6-8-19(18)27-21/h5-15,20H,3-4H2,1-2H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | SNFYYXUGUBUECJ-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-talarozole (CHEBI:102131) is a N-{4-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]phenyl}-1,3-benzothiazol-2-amine (CHEBI:102167) |
| (S)-talarozole (CHEBI:102131) is enantiomer of (R)-talarozole (CHEBI:102030) |
| Incoming Relation(s) |
| talarozole (CHEBI:101854) has part (S)-talarozole (CHEBI:102131) |
| (R)-talarozole (CHEBI:102030) is enantiomer of (S)-talarozole (CHEBI:102131) |
| IUPAC Name |
|---|
| N-{4-[(1S)-2-ethyl-1-(1H-1,2,4-triazol-1-yl)butyl]phenyl}-1,3-benzothiazol-2-amine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18314092 | Reaxys |