EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N4O2S |
| Net Charge | 0 |
| Average Mass | 264.310 |
| Monoisotopic Mass | 264.06810 |
| SMILES | Cc1ccnc(NS(=O)(=O)c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C11H12N4O2S/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey | QPPBRPIAZZHUNT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfamerazine (CHEBI:102130) has functional parent sulfanilamide (CHEBI:45373) |
| sulfamerazine (CHEBI:102130) has role antibacterial agent (CHEBI:33282) |
| sulfamerazine (CHEBI:102130) has role antiinfective agent (CHEBI:35441) |
| sulfamerazine (CHEBI:102130) has role drug allergen (CHEBI:88188) |
| sulfamerazine (CHEBI:102130) is a pyrimidines (CHEBI:39447) |
| sulfamerazine (CHEBI:102130) is a sulfonamide (CHEBI:35358) |
| sulfamerazine (CHEBI:102130) is a sulfonamide antibiotic (CHEBI:87228) |
| IUPAC Name |
|---|
| 4-amino-N-(4-methylpyrimidin-2-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfamerazina | ChemIDplus |
| sulfamerazine | KEGG DRUG |
| sulfamerazinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(4-Aminobenzenesulfonamido)-4-methylpyrimidine | ChemIDplus |
| 2-(p-Aminobenzolsulfonamido)-4-methylpyrimidine | NIST Chemistry WebBook |
| 2-Sulfa-4-methylpyrimidine | ChemIDplus |
| 2-(Sulfanilamido)-4-methylpyrimidine | ChemIDplus |
| 4-Amino-N-(4-methyl-2-pyrimidinyl)-benzenesulfonamide | NIST Chemistry WebBook |
| N-(4-Methyl-2-pyrimidyl)sulfanilamide | ChemIDplus |
| Brand Names | Source |
|---|---|
| Mesulfa | ChEMBL |
| Methypyrimal | ChEMBL |
| Sulfamerazine component of lantrisul | ChEMBL |
| Sulfamerazine component of neotrizine | ChEMBL |
| Sulfamerazine component of sulfaloid | ChEMBL |
| Sulfamerazine component of sulfonamides duplex | ChEMBL |
| Citations |
|---|