EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9FN2O3 |
| Net Charge | 0 |
| Average Mass | 236.202 |
| Monoisotopic Mass | 236.05972 |
| SMILES | O=C1NC(=O)[C@@]2(CCOc3ccc(F)cc32)N1 |
| InChI | InChI=1S/C11H9FN2O3/c12-6-1-2-8-7(5-6)11(3-4-17-8)9(15)13-10(16)14-11/h1-2,5H,3-4H2,(H2,13,14,15,16)/t11-/m0/s1 |
| InChIKey | LXANPKRCLVQAOG-NSHDSACASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sorbinil (CHEBI:102029) has role antioxidant (CHEBI:22586) |
| sorbinil (CHEBI:102029) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| sorbinil (CHEBI:102029) is a azaspiro compound (CHEBI:35624) |
| sorbinil (CHEBI:102029) is a chromanes (CHEBI:23230) |
| sorbinil (CHEBI:102029) is a imidazolidinone (CHEBI:55370) |
| sorbinil (CHEBI:102029) is a organofluorine compound (CHEBI:37143) |
| sorbinil (CHEBI:102029) is a oxaspiro compound (CHEBI:37948) |
| IUPAC Name |
|---|
| (4S)-6-fluoro-2,3-dihydro-2'H,5'H-spiro[chromene-4,4'-imidazolidine]-2',5'-dione |
| INNs | Source |
|---|---|
| sorbinilum | ChemIDplus |
| sorbinilo | ChemIDplus |
| sorbinil | ChemIDplus |
| Synonyms | Source |
|---|---|
| (S)-6-Fluorospiro(chroman-4,4'-imidazolidine)-2',5'-dione | ChemIDplus |
| sorbinol | ChEBI |
| Citations |
|---|