EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N4O3 |
| Net Charge | 0 |
| Average Mass | 214.225 |
| Monoisotopic Mass | 214.10659 |
| SMILES | [N-]=[N+]=NCCCNC(=O)CCCC(=O)O |
| InChI | InChI=1S/C8H14N4O3/c9-12-11-6-2-5-10-7(13)3-1-4-8(14)15/h1-6H2,(H,10,13)(H,14,15) |
| InChIKey | UPZALMCPRFZBAD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(3-azidopropylamino)-5-oxopentanoic acid (CHEBI:100247) is a azide (CHEBI:22680) |
| 5-(3-azidopropylamino)-5-oxopentanoic acid (CHEBI:100247) is a oxo monocarboxylic acid (CHEBI:35871) |
| 5-(3-azidopropylamino)-5-oxopentanoic acid (CHEBI:100247) is a secondary carboxamide (CHEBI:140325) |
| Incoming Relation(s) |
| {5-[(3-azidopropyl)amino]-5-oxopentanoyl}amino group (CHEBI:131507) has functional parent 5-(3-azidopropylamino)-5-oxopentanoic acid (CHEBI:100247) |
| N-succinimidyl 5-(3-azidopropylamino)-5-oxopentanoate (CHEBI:100242) has functional parent 5-(3-azidopropylamino)-5-oxopentanoic acid (CHEBI:100247) |
| IUPAC Name |
|---|
| 5-[(3-azidopropyl)amino]-5-oxopentanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9486198 | Reaxys |