EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H47O3 |
| Net Charge | -1 |
| Average Mass | 455.703 |
| Monoisotopic Mass | 455.35307 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)[O-])CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/p-1/t20-,21-,22+,23-,27-,28+,29+,30-/m0/s1 |
| InChIKey | MIJYXULNPSFWEK-GTOFXWBISA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oleanolate (CHEBI:82828) has role plant metabolite (CHEBI:76924) |
| oleanolate (CHEBI:82828) is a monocarboxylic acid anion (CHEBI:35757) |
| oleanolate (CHEBI:82828) is conjugate base of oleanolic acid (CHEBI:37659) |
| Incoming Relation(s) |
| oleanolic acid (CHEBI:37659) is conjugate acid of oleanolate (CHEBI:82828) |
| IUPAC Name |
|---|
| 3β-hydroxyolean-12-en-28-oate |
| UniProt Name | Source |
|---|---|
| oleanolate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9459 | MetaCyc |
| Citations |
|---|