EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5O4 |
| Net Charge | -1 |
| Average Mass | 117.080 |
| Monoisotopic Mass | 117.01933 |
| SMILES | O=C([O-])CCC(=O)O |
| InChI | InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)/p-1 |
| InChIKey | KDYFGRWQOYBRFD-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| succinate(1−) (CHEBI:30779) has role fundamental metabolite (CHEBI:78675) |
| succinate(1−) (CHEBI:30779) is a dicarboxylic acid monoanion (CHEBI:35695) |
| succinate(1−) (CHEBI:30779) is a succinate (CHEBI:26806) |
| succinate(1−) (CHEBI:30779) is conjugate acid of succinate(2−) (CHEBI:30031) |
| succinate(1−) (CHEBI:30779) is conjugate base of succinic acid (CHEBI:15741) |
| Incoming Relation(s) |
| succinic acid (CHEBI:15741) is conjugate acid of succinate(1−) (CHEBI:30779) |
| succinate(2−) (CHEBI:30031) is conjugate base of succinate(1−) (CHEBI:30779) |
| IUPAC Name |
|---|
| 3-carboxypropanoate |
| Synonyms | Source |
|---|---|
| Butanedioic acid, conjugate base | NIST Chemistry WebBook |
| HOOC‒CH2‒CH2‒COO− | ChEBI |
| hydrogen succinate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:325292 | Gmelin |
| Reaxys:3904279 | Reaxys |