EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N3O7 |
| Net Charge | 0 |
| Average Mass | 265.222 |
| Monoisotopic Mass | 265.09100 |
| SMILES | CN(N=O)C(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O |
| InChI | InChI=1S/C8H15N3O7/c1-11(10-17)8(16)9-4-6(14)5(13)3(2-12)18-7(4)15/h3-7,12-15H,2H2,1H3,(H,9,16)/t3-,4-,5-,6-,7+/m1/s1 |
| InChIKey | ZSJLQEPLLKMAKR-GKHCUFPYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptozocin (CHEBI:9288) has role antimicrobial agent (CHEBI:33281) |
| streptozocin (CHEBI:9288) has role antineoplastic agent (CHEBI:35610) |
| streptozocin (CHEBI:9288) has role DNA synthesis inhibitor (CHEBI:59517) |
| streptozocin (CHEBI:9288) has role metabolite (CHEBI:25212) |
| streptozocin (CHEBI:9288) is a N-acylglucosamine (CHEBI:21638) |
| streptozocin (CHEBI:9288) is a N-nitrosoureas (CHEBI:76551) |
| IUPAC Name |
|---|
| 2-deoxy-2-{[methyl(nitroso)carbamoyl]amino}-α-D-glucopyranose |
| INNs | Source |
|---|---|
| estreptozocina | ChemIDplus |
| streptozocin | KEGG DRUG |
| streptozocine | DrugBank |
| streptozocinum | DrugBank |
| Synonyms | Source |
|---|---|
| 2-Deoxy-2-(3-methyl-3-nitrosoureido)-D-glucopyranose | ChEBI |
| 2-Deoxy-2-(((methylnitrosoamino)carbonyl)amino)-D-glucopyranose | ChemIDplus |
| N-D-Glucosyl-(2)-N'-nitrosomethylharnstoff | ChemIDplus |
| N-D-Glucosyl-(2)-N'-nitrosomethylurea | ChemIDplus |
| Streptozocinium | DrugBank |
| Streptozotocin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| streptozocin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C07313 | KEGG COMPOUND |
| D05932 | KEGG DRUG |
| DB00428 | DrugBank |
| FR1434920 | Patent |
| HMDB0014572 | HMDB |
| Streptozocin | Wikipedia |
| US2005271747 | Patent |
| US2005272738 | Patent |
| US2008085882 | Patent |
| US4156777 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2060675 | Reaxys |
| CAS:18883-66-4 | KEGG COMPOUND |
| CAS:18883-66-4 | ChemIDplus |
| Citations |
|---|