EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N3O7 |
| Net Charge | 0 |
| Average Mass | 265.222 |
| Monoisotopic Mass | 265.09100 |
| SMILES | CN(N=O)C(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O |
| InChI | InChI=1S/C8H15N3O7/c1-11(10-17)8(16)9-4-6(14)5(13)3(2-12)18-7(4)15/h3-7,12-15H,2H2,1H3,(H,9,16)/t3-,4-,5-,6-,7+/m1/s1 |
| InChIKey | ZSJLQEPLLKMAKR-GKHCUFPYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptozocin (CHEBI:9288) has role antimicrobial agent (CHEBI:33281) |
| streptozocin (CHEBI:9288) has role antineoplastic agent (CHEBI:35610) |
| streptozocin (CHEBI:9288) has role DNA synthesis inhibitor (CHEBI:59517) |
| streptozocin (CHEBI:9288) has role metabolite (CHEBI:25212) |
| streptozocin (CHEBI:9288) is a N-acylglucosamine (CHEBI:21638) |
| streptozocin (CHEBI:9288) is a N-nitrosoureas (CHEBI:76551) |
| IUPAC Name |
|---|
| 2-deoxy-2-{[methyl(nitroso)carbamoyl]amino}-α-D-glucopyranose |
| INNs | Source |
|---|---|
| streptozocin | KEGG DRUG |
| streptozocinum | DrugBank |
| streptozocine | DrugBank |
| estreptozocina | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Deoxy-2-(((methylnitrosoamino)carbonyl)amino)-D-glucopyranose | ChemIDplus |
| 2-Deoxy-2-(3-methyl-3-nitrosoureido)-D-glucopyranose | ChEBI |
| N-D-Glucosyl-(2)-N'-nitrosomethylurea | ChemIDplus |
| Streptozotocin | ChemIDplus |
| Streptozocinium | DrugBank |
| N-D-Glucosyl-(2)-N'-nitrosomethylharnstoff | ChemIDplus |
| UniProt Name | Source |
|---|---|
| streptozocin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C07313 | KEGG COMPOUND |
| D05932 | KEGG DRUG |
| DB00428 | DrugBank |
| FR1434920 | Patent |
| Streptozocin | Wikipedia |
| US4156777 | Patent |
| US2008085882 | Patent |
| US2005271747 | Patent |
| US2005272738 | Patent |
| HMDB0014572 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2060675 | Reaxys |
| CAS:18883-66-4 | KEGG COMPOUND |
| CAS:18883-66-4 | ChemIDplus |
| Citations |
|---|