EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O2 |
| Net Charge | 0 |
| Average Mass | 162.188 |
| Monoisotopic Mass | 162.06808 |
| SMILES | C=CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H10O2/c1-2-3-8-4-5-9-10(6-8)12-7-11-9/h2,4-6H,1,3,7H2 |
| InChIKey | ZMQAAUBTXCXRIC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| safrole (CHEBI:8994) has role flavouring agent (CHEBI:35617) |
| safrole (CHEBI:8994) has role insecticide (CHEBI:24852) |
| safrole (CHEBI:8994) has role metabolite (CHEBI:25212) |
| safrole (CHEBI:8994) has role plant metabolite (CHEBI:76924) |
| safrole (CHEBI:8994) is a benzodioxoles (CHEBI:38298) |
| IUPAC Name |
|---|
| 5-allyl-1,3-benzodioxole |
| Synonyms | Source |
|---|---|
| 1,2-methylenedioxy-4-allylbenzene | ChemIDplus |
| 1-allyl-3,4-methylenedioxybenzene | ChemIDplus |
| 3-(3,4-methylenedioxyphenyl)prop-1-ene | NIST Chemistry WebBook |
| 3,4-(methylenedioxy)allylbenzene | ChemIDplus |
| 4-allyl-1,2-methylenedioxybenzene | ChemIDplus |
| 4-allylpyrocatechol formaldehyde acetal | ChemIDplus |
| Citations |
|---|