EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O2 |
| Net Charge | 0 |
| Average Mass | 162.188 |
| Monoisotopic Mass | 162.06808 |
| SMILES | C=CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H10O2/c1-2-3-8-4-5-9-10(6-8)12-7-11-9/h2,4-6H,1,3,7H2 |
| InChIKey | ZMQAAUBTXCXRIC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| safrole (CHEBI:8994) has role flavouring agent (CHEBI:35617) |
| safrole (CHEBI:8994) has role insecticide (CHEBI:24852) |
| safrole (CHEBI:8994) has role metabolite (CHEBI:25212) |
| safrole (CHEBI:8994) has role plant metabolite (CHEBI:76924) |
| safrole (CHEBI:8994) is a benzodioxoles (CHEBI:38298) |
| IUPAC Name |
|---|
| 5-allyl-1,3-benzodioxole |
| Synonyms | Source |
|---|---|
| 1,2-methylenedioxy-4-allylbenzene | ChemIDplus |
| 1-allyl-3,4-methylenedioxybenzene | ChemIDplus |
| 3-(3,4-methylenedioxyphenyl)prop-1-ene | NIST Chemistry WebBook |
| 3,4-(methylenedioxy)allylbenzene | ChemIDplus |
| 4-allyl-1,2-methylenedioxybenzene | ChemIDplus |
| 4-allylpyrocatechol formaldehyde acetal | ChemIDplus |
| Citations |
|---|