EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:88014 - Sudan IV
| Formula | C24H20N4O |
| Net Charge | 0 |
| Average Mass | 380.451 |
| Monoisotopic Mass | 380.16371 |
| SMILES | Cc1ccccc1N=Nc1ccc(N=Nc2c(O)ccc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C24H20N4O/c1-16-7-3-6-10-21(16)26-25-19-12-13-22(17(2)15-19)27-28-24-20-9-5-4-8-18(20)11-14-23(24)29/h3-15,29H,1-2H3 |
| InChIKey | RCTGMCJBQGBLKT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sudan IV (CHEBI:88014) has functional parent 2-naphthol (CHEBI:10432) |
| Sudan IV (CHEBI:88014) has role carcinogenic agent (CHEBI:50903) |
| Sudan IV (CHEBI:88014) has role fluorochrome (CHEBI:51217) |
| Sudan IV (CHEBI:88014) has role histological dye (CHEBI:77178) |
| Sudan IV (CHEBI:88014) is a azobenzenes (CHEBI:22682) |
| Sudan IV (CHEBI:88014) is a bis(azo) compound (CHEBI:48960) |
| Sudan IV (CHEBI:88014) is a naphthols (CHEBI:25392) |
| IUPAC Name |
|---|
| 1-({2-methyl-4-[(2-methylphenyl)diazenyl]phenyl}diazenyl)naphthalen-2-ol |
| Synonyms | Source |
|---|---|
| 1-[2-[2-Methyl-4-[2-(2-methylphenyl)diazenyl]phenyl]diazenyl]-2-naphthalenol | KEGG COMPOUND |
| 1-(2-Methyl-4-(2-methylphenylazo)phenylazo)-2-naphthol | ChemIDplus |
| 1-(4-o-Tolylazo-o-tolylazo)-2-naphthol | ChemIDplus |
| 2',3-Dimethyl-4-(2-hydroxynaphthylazo)azobenzene | ChemIDplus |
| Biebrich scarlet R | ChEBI |
| C.I. 26105 | ChEBI |