EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:74460 - 5-chloro-7-iodoquinolin-8-ol
| Formula | C9H5ClINO |
| Net Charge | 0 |
| Average Mass | 305.502 |
| Monoisotopic Mass | 304.91044 |
| SMILES | Oc1c(I)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C9H5ClINO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
| InChIKey | QCDFBFJGMNKBDO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antibacterial agent (CHEBI:33282) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antifungal agent (CHEBI:35718) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antimicrobial agent (CHEBI:33281) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antineoplastic agent (CHEBI:35610) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antiprotozoal drug (CHEBI:35820) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role chelator (CHEBI:38161) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role copper chelator (CHEBI:166831) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a monohydroxyquinoline (CHEBI:38775) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a organochlorine compound (CHEBI:36683) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 5-chloro-7-iodoquinolin-8-ol |
| INNs | Source |
|---|---|
| clioquinol | ChemIDplus |
| clioquinol | WHO MedNet |
| clioquinol | WHO MedNet |
| clioquinolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-chloro-8-hydroxy-7-iodoquinoline | ChemIDplus |
| 7-iodo-5-chloroxine | ChemIDplus |
| 5-Chlor-7-jod-8-hydroxy-chinolin | ChemIDplus |
| 5-chloro-7-iodo-8-hydroxyquinoline | ChemIDplus |
| 7-iodo-5-chloro-8-hydroxyquinoline | ChemIDplus |
| iodochlorohydroxyquin | ChemIDplus |
| Citations |
|---|