EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:74460 - 5-chloro-7-iodoquinolin-8-ol
| Formula | C9H5ClINO |
| Net Charge | 0 |
| Average Mass | 305.502 |
| Monoisotopic Mass | 304.91044 |
| SMILES | Oc1c(I)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C9H5ClINO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
| InChIKey | QCDFBFJGMNKBDO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticonvulsant A drug used to prevent seizures or reduce their severity. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antiamoebic agent (CHEBI:171664) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antibacterial agent (CHEBI:33282) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role anticonvulsant (CHEBI:35623) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antifungal agent (CHEBI:35718) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antimicrobial agent (CHEBI:33281) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antineoplastic agent (CHEBI:35610) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antiprotozoal drug (CHEBI:35820) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role chelator (CHEBI:38161) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role copper chelator (CHEBI:166831) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role dermatologic drug (CHEBI:50177) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a monohydroxyquinoline (CHEBI:38775) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a organic molecular entity (CHEBI:50860) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a organochlorine compound (CHEBI:36683) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a organohalogen compound (CHEBI:17792) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a organoiodine compound (CHEBI:37142) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 5-chloro-7-iodoquinolin-8-ol |
| INNs | Source |
|---|---|
| clioquinol | ChemIDplus |
| clioquinol | WHO MedNet |
| clioquinol | WHO MedNet |
| clioquinolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-stearylamino-phenyl-trimethylam. metilsulf. | ChEMBL |
| 5-Chlor-7-jod-8-hydroxy-chinolin | ChemIDplus |
| 5-chloro-7-iodo-8-hydroxyquinoline | ChemIDplus |
| 5-chloro-7-iodo-8-quinolinol | ChemIDplus |
| 5-chloro-8-hydroxy-7-iodoquinoline | ChemIDplus |
| 7-iodo-5-chloro-8-hydroxyquinoline | ChemIDplus |
| Brand Names | Source |
|---|---|
| Clioquinol component of nystaform | ChEMBL |
| Oralcer | ChEMBL |
| Vioform | ChEMBL |
| Citations |
|---|