EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H5ClINO |
| Net Charge | 0 |
| Average Mass | 305.502 |
| Monoisotopic Mass | 304.91044 |
| SMILES | Oc1c(I)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C9H5ClINO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
| InChIKey | QCDFBFJGMNKBDO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antibacterial agent (CHEBI:33282) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antifungal agent (CHEBI:35718) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antimicrobial agent (CHEBI:33281) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antineoplastic agent (CHEBI:35610) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role antiprotozoal drug (CHEBI:35820) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role chelator (CHEBI:38161) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) has role copper chelator (CHEBI:166831) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a monohydroxyquinoline (CHEBI:38775) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a organochlorine compound (CHEBI:36683) |
| 5-chloro-7-iodoquinolin-8-ol (CHEBI:74460) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 5-chloro-7-iodoquinolin-8-ol |
| INNs | Source |
|---|---|
| clioquinol | WHO MedNet |
| clioquinol | WHO MedNet |
| clioquinol | ChemIDplus |
| clioquinolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Chlor-7-jod-8-hydroxy-chinolin | ChemIDplus |
| 5-chloro-7-iodo-8-hydroxyquinoline | ChemIDplus |
| 5-chloro-7-iodo-8-quinolinol | ChemIDplus |
| 5-chloro-8-hydroxy-7-iodoquinoline | ChemIDplus |
| 7-iodo-5-chloro-8-hydroxyquinoline | ChemIDplus |
| 7-iodo-5-chloroxine | ChemIDplus |
| Citations |
|---|