EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NO8 |
| Net Charge | 0 |
| Average Mass | 331.321 |
| Monoisotopic Mass | 331.12672 |
| SMILES | CNCc1cc(O)cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C14H21NO8/c1-15-4-6-2-7(17)3-8(10(6)18)22-14-13(21)12(20)11(19)9(5-16)23-14/h2-3,9,11-21H,4-5H2,1H3/t9-,11-,12+,13-,14-/m1/s1 |
| InChIKey | XDRANPRXTFIDRB-RGCYKPLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anagallis monelli (ncbitaxon:306291) | aerial part (BTO:0001658) | PubMed (17329877) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zinolol (CHEBI:66506) has role antimutagen (CHEBI:73190) |
| zinolol (CHEBI:66506) has role antioxidant (CHEBI:22586) |
| zinolol (CHEBI:66506) has role metabolite (CHEBI:25212) |
| zinolol (CHEBI:66506) is a hydroquinones (CHEBI:24646) |
| zinolol (CHEBI:66506) is a monosaccharide derivative (CHEBI:63367) |
| zinolol (CHEBI:66506) is a secondary amino compound (CHEBI:50995) |
| zinolol (CHEBI:66506) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2,5-dihydroxy-3-[(methylamino)methyl]phenyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 2-(O-β-D-glucopyranosyl)-6-(N-methylaminomethyl)-1,4-dihydroxybenzene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11028017 | Reaxys |
| Citations |
|---|