EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NO8 |
| Net Charge | 0 |
| Average Mass | 331.321 |
| Monoisotopic Mass | 331.12672 |
| SMILES | CNCc1cc(O)cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C14H21NO8/c1-15-4-6-2-7(17)3-8(10(6)18)22-14-13(21)12(20)11(19)9(5-16)23-14/h2-3,9,11-21H,4-5H2,1H3/t9-,11-,12+,13-,14-/m1/s1 |
| InChIKey | XDRANPRXTFIDRB-RGCYKPLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anagallis monelli (ncbitaxon:306291) | aerial part (BTO:0001658) | PubMed (17329877) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zinolol (CHEBI:66506) has role antimutagen (CHEBI:73190) |
| zinolol (CHEBI:66506) has role antioxidant (CHEBI:22586) |
| zinolol (CHEBI:66506) has role metabolite (CHEBI:25212) |
| zinolol (CHEBI:66506) is a hydroquinones (CHEBI:24646) |
| zinolol (CHEBI:66506) is a monosaccharide derivative (CHEBI:63367) |
| zinolol (CHEBI:66506) is a secondary amino compound (CHEBI:50995) |
| zinolol (CHEBI:66506) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2,5-dihydroxy-3-[(methylamino)methyl]phenyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 2-(O-β-D-glucopyranosyl)-6-(N-methylaminomethyl)-1,4-dihydroxybenzene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11028017 | Reaxys |
| Citations |
|---|