EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N6O |
| Net Charge | 0 |
| Average Mass | 182.187 |
| Monoisotopic Mass | 182.09161 |
| SMILES | CN(C)N=Nc1ncnc1C(N)=O |
| InChI | InChI=1S/C6H10N6O/c1-12(2)11-10-6-4(5(7)13)8-3-9-6/h3H,1-2H3,(H2,7,13)(H,8,9) |
| InChIKey | FDKXTQMXEQVLRF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dacarbazine (CHEBI:4305) has role alkylating agent (CHEBI:22333) |
| dacarbazine (CHEBI:4305) has role antineoplastic agent (CHEBI:35610) |
| dacarbazine (CHEBI:4305) has role carcinogenic agent (CHEBI:50903) |
| dacarbazine (CHEBI:4305) has role prodrug (CHEBI:50266) |
| dacarbazine (CHEBI:4305) is a imidazoles (CHEBI:24780) |
| dacarbazine (CHEBI:4305) is a monocarboxylic acid amide (CHEBI:29347) |
| dacarbazine (CHEBI:4305) is a triazene derivative (CHEBI:72573) |
| Incoming Relation(s) |
| (E)-dacarbazine (CHEBI:177836) is a dacarbazine (CHEBI:4305) |
| IUPAC Name |
|---|
| 5-(3,3-dimethyltriaz-1-en-1-yl)-1H-imidazole-4-carboxamide |
| INNs | Source |
|---|---|
| dacarbazina | WHO MedNet |
| dacarbazine | WHO MedNet |
| dacarbazine | WHO MedNet |
| dacarbazinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-(3,3-dimethyl-1-triazeno)imidazole-5-carboxamide | ChemIDplus |
| 4-(5)-(3,3-dimethyl-1-triazeno)imidazole-5(4)-carboxamide | ChemIDplus |
| 4-(dimethyltriazeno)imidazole-5-carboxamide | ChemIDplus |
| 5-(3,3-dimethyl-1-triazeno)imidazole-4-carboxamide | ChemIDplus |
| 5-(3,3-Dimethyl-1-triazeno)imidazole-4-carboxamide | ChemIDplus |
| 5-(3,3-dimethyltriazeno)imidazole-4-carboxamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 773 | DrugCentral |
| C06936 | KEGG COMPOUND |
| D00288 | KEGG DRUG |
| Dacarbazine | Wikipedia |
| DB00851 | DrugBank |
| HMDB0014989 | HMDB |
| LSM-5487 | LINCS |
| Citations |
|---|