EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O3S |
| Net Charge | 0 |
| Average Mass | 260.314 |
| Monoisotopic Mass | 260.05072 |
| SMILES | CC(C(=O)O)c1ccc(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C14H12O3S/c1-9(14(16)17)11-7-8-12(18-11)13(15)10-5-3-2-4-6-10/h2-9H,1H3,(H,16,17) |
| InChIKey | GUHPRPJDBZHYCJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiaprofenic acid (CHEBI:32221) has role drug allergen (CHEBI:88188) |
| tiaprofenic acid (CHEBI:32221) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| tiaprofenic acid (CHEBI:32221) is a aromatic ketone (CHEBI:76224) |
| tiaprofenic acid (CHEBI:32221) is a monocarboxylic acid (CHEBI:25384) |
| tiaprofenic acid (CHEBI:32221) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 2-(5-benzoylthiophen-2-yl)propanoic acid |
| INNs | Source |
|---|---|
| acide tiaprofenique | ChemIDplus |
| acido tiaprofenico | ChemIDplus |
| acidum tiaprofenicum | ChemIDplus |
| tiaprofenic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(5-Benzoyl-thiophen-2-yl)-propionic acid | ChEMBL |
| 2-(5-Benzyl-2-thienyl)propionsäure | ChemIDplus |
| 5-benzoyl-α-methyl-2-thiopheneacetic acid | ChEBI |
| 5-benzoyl-α-methylthiophene-2-acetic acid | ChemIDplus |
| Tiaprofensäure | ChemIDplus |
| α-methyl-5-benzoyl-2-thienylacetic acid | ChEBI |
| Citations |
|---|