EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O3S |
| Net Charge | 0 |
| Average Mass | 260.314 |
| Monoisotopic Mass | 260.05072 |
| SMILES | CC(C(=O)O)c1ccc(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C14H12O3S/c1-9(14(16)17)11-7-8-12(18-11)13(15)10-5-3-2-4-6-10/h2-9H,1H3,(H,16,17) |
| InChIKey | GUHPRPJDBZHYCJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiaprofenic acid (CHEBI:32221) has role drug allergen (CHEBI:88188) |
| tiaprofenic acid (CHEBI:32221) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| tiaprofenic acid (CHEBI:32221) is a aromatic ketone (CHEBI:76224) |
| tiaprofenic acid (CHEBI:32221) is a monocarboxylic acid (CHEBI:25384) |
| tiaprofenic acid (CHEBI:32221) is a organic molecular entity (CHEBI:50860) |
| tiaprofenic acid (CHEBI:32221) is a racemate (CHEBI:60911) |
| tiaprofenic acid (CHEBI:32221) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 2-(5-benzoylthiophen-2-yl)propanoic acid |
| INNs | Source |
|---|---|
| acide tiaprofenique | ChemIDplus |
| acido tiaprofenico | ChemIDplus |
| acidum tiaprofenicum | ChemIDplus |
| tiaprofenic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(5-Benzoyl-thiophen-2-yl)-propionic acid | ChEMBL |
| 2-(5-Benzyl-2-thienyl)propionsäure | ChemIDplus |
| 5-benzoyl-α-methyl-2-thiopheneacetic acid | ChEBI |
| 5-benzoyl-α-methylthiophene-2-acetic acid | ChemIDplus |
| RU-15060 | ChEMBL |
| Surgam | ChEMBL |
| Brand Names | Source |
|---|---|
| Surgam 200 | ChEMBL |
| Surgam 300 | ChEMBL |
| Surgam sa | ChEMBL |
| Citations |
|---|