EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H69NO15 |
| Net Charge | 0 |
| Average Mass | 828.006 |
| Monoisotopic Mass | 827.46672 |
| SMILES | CO[C@@H]1[C@@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]3C[C@@](C)(O)[C@@H](OC(=O)CC(C)C)[C@H](C)O3)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@@H](C)[C@@H](O)/C=C/C=C/C[C@@H](C)OC(=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C42H69NO15/c1-23(2)19-32(47)56-40-27(6)53-34(22-42(40,8)50)57-37-26(5)54-41(36(49)35(37)43(9)10)58-38-29(17-18-44)20-24(3)30(46)16-14-12-13-15-25(4)52-33(48)21-31(39(38)51-11)55-28(7)45/h12-14,16,18,23-27,29-31,34-41,46,49-50H,15,17,19-22H2,1-11H3/b13-12+,16-14+/t24-,25-,26-,27+,29+,30+,31-,34+,35-,36-,37-,38+,39+,40+,41+,42-/m1/s1 |
| InChIKey | XJSFLOJWULLJQS-NGVXBBESSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| josamycin (CHEBI:31739) has role antibacterial drug (CHEBI:36047) |
| josamycin (CHEBI:31739) has role metabolite (CHEBI:25212) |
| josamycin (CHEBI:31739) is a acetate ester (CHEBI:47622) |
| josamycin (CHEBI:31739) is a aldehyde (CHEBI:17478) |
| josamycin (CHEBI:31739) is a disaccharide derivative (CHEBI:63353) |
| josamycin (CHEBI:31739) is a glycoside (CHEBI:24400) |
| josamycin (CHEBI:31739) is a macrolide antibiotic (CHEBI:25105) |
| josamycin (CHEBI:31739) is a tertiary alcohol (CHEBI:26878) |
| josamycin (CHEBI:31739) is a tertiary amino compound (CHEBI:50996) |
| INNs | Source |
|---|---|
| josamicina | ChemIDplus |
| josamycin | ChemIDplus |
| josamycine | ChemIDplus |
| josamycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| antibiotic yl-704 A3 | ChemIDplus |
| EN-141 | ChemIDplus |
| JM | KEGG DRUG |
| kitasamycin A3 | ChemIDplus |
| leucomycin A3 | ChemIDplus |
| leucomycin A3 | ChEBI |
| Citations |
|---|