EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H69NO15 |
| Net Charge | 0 |
| Average Mass | 828.006 |
| Monoisotopic Mass | 827.46672 |
| SMILES | CO[C@@H]1[C@@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]3C[C@@](C)(O)[C@@H](OC(=O)CC(C)C)[C@H](C)O3)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@@H](C)[C@@H](O)/C=C/C=C/C[C@@H](C)OC(=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C42H69NO15/c1-23(2)19-32(47)56-40-27(6)53-34(22-42(40,8)50)57-37-26(5)54-41(36(49)35(37)43(9)10)58-38-29(17-18-44)20-24(3)30(46)16-14-12-13-15-25(4)52-33(48)21-31(39(38)51-11)55-28(7)45/h12-14,16,18,23-27,29-31,34-41,46,49-50H,15,17,19-22H2,1-11H3/b13-12+,16-14+/t24-,25-,26-,27+,29+,30+,31-,34+,35-,36-,37-,38+,39+,40+,41+,42-/m1/s1 |
| InChIKey | XJSFLOJWULLJQS-NGVXBBESSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| josamycin (CHEBI:31739) has role antibacterial drug (CHEBI:36047) |
| josamycin (CHEBI:31739) has role metabolite (CHEBI:25212) |
| josamycin (CHEBI:31739) is a acetate ester (CHEBI:47622) |
| josamycin (CHEBI:31739) is a aldehyde (CHEBI:17478) |
| josamycin (CHEBI:31739) is a disaccharide derivative (CHEBI:63353) |
| josamycin (CHEBI:31739) is a glycoside (CHEBI:24400) |
| josamycin (CHEBI:31739) is a macrolide antibiotic (CHEBI:25105) |
| josamycin (CHEBI:31739) is a tertiary alcohol (CHEBI:26878) |
| josamycin (CHEBI:31739) is a tertiary amino compound (CHEBI:50996) |
| INNs | Source |
|---|---|
| josamicina | ChemIDplus |
| josamycin | ChemIDplus |
| josamycine | ChemIDplus |
| josamycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| antibiotic yl-704 A3 | ChemIDplus |
| EN-141 | ChemIDplus |
| JM | KEGG DRUG |
| kitasamycin A3 | ChemIDplus |
| leucomycin A3 | ChemIDplus |
| leucomycin A3 | ChEBI |
| Citations |
|---|