EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11NO2 |
| Net Charge | 0 |
| Average Mass | 213.236 |
| Monoisotopic Mass | 213.07898 |
| SMILES | O=C(OCc1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C13H11NO2/c15-13(12-7-4-8-14-9-12)16-10-11-5-2-1-3-6-11/h1-9H,10H2 |
| InChIKey | KVYGGMBOZFWZBQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzyl nicotinate (CHEBI:31268) has functional parent nicotinic acid (CHEBI:15940) |
| benzyl nicotinate (CHEBI:31268) has role vasodilator agent (CHEBI:35620) |
| benzyl nicotinate (CHEBI:31268) is a benzyl ester (CHEBI:90628) |
| IUPAC Name |
|---|
| benzyl nicotinate |
| Synonyms | Source |
|---|---|
| 3-pyridinecarboxylic acid phenylmethyl ester | ChemIDplus |
| benzyl pyridine-3-carboxylate | ChemIDplus |
| nicotinic acid benzyl ester | ChemIDplus |
| phenylmethyl 3-pyridinecarboxylate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Pycaril | ChemIDplus |
| Pykaryl | ChemIDplus |
| Rubriment | ChemIDplus |
| Citations |
|---|