EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O4 |
| Net Charge | 0 |
| Average Mass | 338.488 |
| Monoisotopic Mass | 338.24571 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@](C)(CC[C@@H](O)[C@@]3(C)CO)[C@]13CC[C@](O)(CO)[C@H](C2)C3 |
| InChI | InChI=1S/C20H34O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-16,21-24H,3-12H2,1-2H3/t13-,14+,15-,16+,17-,18-,19-,20-/m0/s1 |
| InChIKey | NOFOAYPPHIUXJR-APNQCZIXSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus oryzae (ncbitaxon:5062) | - | PubMed (29191129) | |
| Cephalosporium aphidicola (ncbitaxon:291364) | - | PubMed (21812410) | |
| Tolypocladium inflatum (ncbitaxon:29910) | - | PubMed (21812410) | Ethylacetate extract and fungus isolated from a soil sample on fruiting body of Cordyceps sinensis |
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antimitotic Any compound that inhibits cell division (mitosis). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aphidicolin (CHEBI:2766) has role Aspergillus metabolite (CHEBI:76956) |
| aphidicolin (CHEBI:2766) has role antimicrobial agent (CHEBI:33281) |
| aphidicolin (CHEBI:2766) has role antimitotic (CHEBI:64911) |
| aphidicolin (CHEBI:2766) has role antineoplastic agent (CHEBI:35610) |
| aphidicolin (CHEBI:2766) has role antiviral drug (CHEBI:36044) |
| aphidicolin (CHEBI:2766) has role apoptosis inducer (CHEBI:68495) |
| aphidicolin (CHEBI:2766) has role DNA synthesis inhibitor (CHEBI:59517) |
| aphidicolin (CHEBI:2766) has role EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor (CHEBI:131699) |
| aphidicolin (CHEBI:2766) has role fungal metabolite (CHEBI:76946) |
| aphidicolin (CHEBI:2766) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (3R,4R,4aR,6aS,8R,9R,11aS,11bS)-4,9-bis(hydroxymethyl)-4,11b-dimethyltetradecahydro-8,11a-methanocyclohepta[a]naphthalene-3,9-diol |
| Synonyms | Source |
|---|---|
| (3α,4α,5α,17α)-3,17-dihydroxy-4-methyl-9,15-cyclo-C,18-dinor-14,15-secoandrostane-4,17-dimethanol | ChEBI |
| Aphidicolin | KEGG COMPOUND |
| aphidocolin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2055641 | Reaxys |
| Beilstein:4689958 | Beilstein |
| CAS:38966-21-1 | KEGG COMPOUND |
| CAS:38966-21-1 | ChemIDplus |
| Citations |
|---|