EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O4 |
| Net Charge | 0 |
| Average Mass | 338.488 |
| Monoisotopic Mass | 338.24571 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@](C)(CC[C@@H](O)[C@@]3(C)CO)[C@]13CC[C@](O)(CO)[C@H](C2)C3 |
| InChI | InChI=1S/C20H34O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-16,21-24H,3-12H2,1-2H3/t13-,14+,15-,16+,17-,18-,19-,20-/m0/s1 |
| InChIKey | NOFOAYPPHIUXJR-APNQCZIXSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cephalosporium aphidicola (ncbitaxon:291364) | - | PubMed (21812410) | |
| Tolypocladium inflatum (ncbitaxon:29910) | - | PubMed (21812410) | Ethylacetate extract and fungus isolated from a soil sample on fruiting body of Cordyceps sinensis |
| Aspergillus oryzae (ncbitaxon:5062) | - | PubMed (29191129) |
| Roles Classification |
|---|
| Biological Roles: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimitotic Any compound that inhibits cell division (mitosis). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aphidicolin (CHEBI:2766) has role Aspergillus metabolite (CHEBI:76956) |
| aphidicolin (CHEBI:2766) has role antimicrobial agent (CHEBI:33281) |
| aphidicolin (CHEBI:2766) has role antimitotic (CHEBI:64911) |
| aphidicolin (CHEBI:2766) has role antineoplastic agent (CHEBI:35610) |
| aphidicolin (CHEBI:2766) has role antiviral drug (CHEBI:36044) |
| aphidicolin (CHEBI:2766) has role apoptosis inducer (CHEBI:68495) |
| aphidicolin (CHEBI:2766) has role DNA synthesis inhibitor (CHEBI:59517) |
| aphidicolin (CHEBI:2766) has role EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor (CHEBI:131699) |
| aphidicolin (CHEBI:2766) has role fungal metabolite (CHEBI:76946) |
| aphidicolin (CHEBI:2766) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (3R,4R,4aR,6aS,8R,9R,11aS,11bS)-4,9-bis(hydroxymethyl)-4,11b-dimethyltetradecahydro-8,11a-methanocyclohepta[a]naphthalene-3,9-diol |
| Synonyms | Source |
|---|---|
| Aphidicolin | KEGG COMPOUND |
| aphidocolin | ChEBI |
| (3α,4α,5α,17α)-3,17-dihydroxy-4-methyl-9,15-cyclo-C,18-dinor-14,15-secoandrostane-4,17-dimethanol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2055641 | Reaxys |
| Beilstein:4689958 | Beilstein |
| CAS:38966-21-1 | KEGG COMPOUND |
| CAS:38966-21-1 | ChemIDplus |
| Citations |
|---|