EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8NO3 |
| Net Charge | -1 |
| Average Mass | 166.156 |
| Monoisotopic Mass | 166.05097 |
| SMILES | COc1cccc(C(=O)[O-])c1N |
| InChI | InChI=1S/C8H9NO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,9H2,1H3,(H,10,11)/p-1 |
| InChIKey | SXOPCLUOUFQBJV-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (9660093) |
| Roles Classification |
|---|
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methoxyanthranilate (CHEBI:20109) has functional parent anthranilate (CHEBI:16567) |
| 3-methoxyanthranilate (CHEBI:20109) has role mammalian metabolite (CHEBI:75768) |
| 3-methoxyanthranilate (CHEBI:20109) is a aminobenzoate (CHEBI:22494) |
| 3-methoxyanthranilate (CHEBI:20109) is conjugate base of 3-methoxyanthranilic acid (CHEBI:27440) |
| Incoming Relation(s) |
| 3-methoxyanthranilic acid (CHEBI:27440) is conjugate acid of 3-methoxyanthranilate (CHEBI:20109) |
| IUPAC Name |
|---|
| 2-amino-3-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| C05831 | KEGG COMPOUND |