EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO3 |
| Net Charge | 0 |
| Average Mass | 167.164 |
| Monoisotopic Mass | 167.05824 |
| SMILES | COc1cccc(C(=O)O)c1N |
| InChI | InChI=1S/C8H9NO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | SXOPCLUOUFQBJV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (9660093) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methoxyanthranilic acid (CHEBI:27440) has functional parent anthranilic acid (CHEBI:30754) |
| 3-methoxyanthranilic acid (CHEBI:27440) has role mammalian metabolite (CHEBI:75768) |
| 3-methoxyanthranilic acid (CHEBI:27440) is a aminobenzoic acid (CHEBI:22495) |
| 3-methoxyanthranilic acid (CHEBI:27440) is a benzoic acids (CHEBI:22723) |
| 3-methoxyanthranilic acid (CHEBI:27440) is conjugate acid of 3-methoxyanthranilate (CHEBI:20109) |
| Incoming Relation(s) |
| 3-methoxyanthranilate (CHEBI:20109) is conjugate base of 3-methoxyanthranilic acid (CHEBI:27440) |
| IUPAC Name |
|---|
| 2-amino-3-methoxybenzoic acid |
| Synonym | Source |
|---|---|
| 3-Methoxyanthranilic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05831 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1450812 | Reaxys |
| Citations |
|---|