EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N5O11P2 |
| Net Charge | 0 |
| Average Mass | 443.202 |
| Monoisotopic Mass | 443.02433 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H15N5O11P2/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(25-9)1-24-28(22,23)26-27(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | QGWNDRXFNXRZMB-UUOKFMHZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | uncoupling protein inhibitor Any inhibitor that acts on uncoupling protein. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDP (CHEBI:17552) has role Escherichia coli metabolite (CHEBI:76971) |
| GDP (CHEBI:17552) has role mouse metabolite (CHEBI:75771) |
| GDP (CHEBI:17552) has role uncoupling protein inhibitor (CHEBI:145437) |
| GDP (CHEBI:17552) is a guanosine 5'-phosphate (CHEBI:37121) |
| GDP (CHEBI:17552) is a purine ribonucleoside 5'-diphosphate (CHEBI:37038) |
| GDP (CHEBI:17552) is conjugate acid of GDP(2−) (CHEBI:65180) |
| Incoming Relation(s) |
| 2'-MANT-GDP (CHEBI:85432) has functional parent GDP (CHEBI:17552) |
| 3'-MANT-GDP (CHEBI:85434) has functional parent GDP (CHEBI:17552) |
| 7-methylguanosine 5'-diphosphate (CHEBI:63729) has functional parent GDP (CHEBI:17552) |
| 7-methylguanosine 5'-diphosphate(1+) (CHEBI:63730) has functional parent GDP (CHEBI:17552) |
| 8-oxo-GDP (CHEBI:65134) has functional parent GDP (CHEBI:17552) |
| GDP-sugar (CHEBI:21169) has functional parent GDP (CHEBI:17552) |
| GDP-valienol (CHEBI:128754) has functional parent GDP (CHEBI:17552) |
| GDP-β-S (CHEBI:38309) has functional parent GDP (CHEBI:17552) |
| MANT-GDP (CHEBI:84677) has functional parent GDP (CHEBI:17552) |
| GDP(2−) (CHEBI:65180) is conjugate base of GDP (CHEBI:17552) |
| IUPAC Name |
|---|
| guanosine 5'-(trihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| GDP | KEGG COMPOUND |
| Guanosine 5'-diphosphate | KEGG COMPOUND |
| Guanosine diphosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00035 | KEGG COMPOUND |
| C00035 | KEGG COMPOUND |
| GDP | PDBeChem |
| DB04315 | DrugBank |
| G10620 | KEGG GLYCAN |
| HMDB0001201 | HMDB |
| Guanosine_diphosphate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:146-91-8 | KEGG COMPOUND |
| Citations |
|---|