EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12C=C(C)CCC1=C(C)CC[C@H]2C(C)C |
| InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,13,15H,5-8H2,1-4H3/t13-,15-/m0/s1 |
| InChIKey | FUCYIEXQVQJBKY-ZFWWWQNUSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-δ-cadinene (CHEBI:15385) is a cadinene (CHEBI:22976) |
| (+)-δ-cadinene (CHEBI:15385) is a δ-cadinene (CHEBI:140564) |
| (+)-δ-cadinene (CHEBI:15385) is enantiomer of (−)-δ-cadinene (CHEBI:63703) |
| Incoming Relation(s) |
| (−)-δ-cadinene (CHEBI:63703) is enantiomer of (+)-δ-cadinene (CHEBI:15385) |
| IUPAC Name |
|---|
| cadina-1(10),4-diene |
| Synonyms | Source |
|---|---|
| (1S,8aR)-4,7-dimethyl-1-(propan-2-yl)-1,2,3,5,6,8a-hexahydronaphthalene | IUPAC |
| (+)-delta-Cadinene | KEGG COMPOUND |
| δ-amorphene | NIST Chemistry WebBook |
| δ-cadinene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (1S,8aR)-δ-cadinene | UniProt |