EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC1=CC2C(=C(C)CCC2C(C)C)CC1 |
| InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,13,15H,5-8H2,1-4H3 |
| InChIKey | FUCYIEXQVQJBKY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| δ-cadinene (CHEBI:140564) is a cadinene (CHEBI:22976) |
| δ-cadinene (CHEBI:140564) is a hexahydronaphthalenes (CHEBI:142348) |
| Incoming Relation(s) |
| (+)-δ-cadinene (CHEBI:15385) is a δ-cadinene (CHEBI:140564) |
| (−)-δ-cadinene (CHEBI:63703) is a δ-cadinene (CHEBI:140564) |
| IUPAC Name |
|---|
| rel-(1R,8aS)-1-isopropyl-4,7-dimethyl-1,2,3,5,6,8a-hexahydronaphthalene |
| Synonyms | Source |
|---|---|
| 4,7-dimethyl-1-(propan-2-yl)-1,2,3,5,6,8a-hexahydronaphthalene | SUBMITTER |
| 4,7-dimethyl-1-isopropyl-1,2,3,5,6,8a-hexahydronaphthalene | SUBMITTER |
| UniProt Name | Source |
|---|---|
| δ-cadinene | UniProt |