EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N3O5S2 |
| Net Charge | 0 |
| Average Mass | 423.516 |
| Monoisotopic Mass | 423.09226 |
| SMILES | CC1(C)SCCN(S(=O)(=O)c2ccc(Oc3ccncc3)cc2)[C@H]1C(=O)NO |
| InChI | InChI=1S/C18H21N3O5S2/c1-18(2)16(17(22)20-23)21(11-12-27-18)28(24,25)15-5-3-13(4-6-15)26-14-7-9-19-10-8-14/h3-10,16,23H,11-12H2,1-2H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | YKPYIPVDTNNYCN-INIZCTEOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.24.35 (gelatinase B) inhibitor An EC 3.4.24.* (metalloendopeptidase) inhibitor that interferes with the action of gelatinase B (EC 3.4.24.35). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prinomastat (CHEBI:138885) has role antineoplastic agent (CHEBI:35610) |
| prinomastat (CHEBI:138885) has role EC 3.4.24.35 (gelatinase B) inhibitor (CHEBI:79088) |
| prinomastat (CHEBI:138885) has role matrix metalloproteinase inhibitor (CHEBI:50664) |
| prinomastat (CHEBI:138885) is a aromatic ether (CHEBI:35618) |
| prinomastat (CHEBI:138885) is a hydroxamic acid (CHEBI:24650) |
| prinomastat (CHEBI:138885) is a pyridines (CHEBI:26421) |
| prinomastat (CHEBI:138885) is a sulfonamide (CHEBI:35358) |
| prinomastat (CHEBI:138885) is a thiomorpholines (CHEBI:36393) |
| prinomastat (CHEBI:138885) is conjugate base of prinomastat(1+) (CHEBI:138886) |
| Incoming Relation(s) |
| prinomastat(1+) (CHEBI:138886) is conjugate acid of prinomastat (CHEBI:138885) |
| IUPAC Name |
|---|
| (3S)-N-hydroxy-2,2-dimethyl-4-{[4-(pyridin-4-yloxy)phenyl]sulfonyl}thiomorpholine-3-carboxamide |
| INNs | Source |
|---|---|
| prinomastat | WHO MedNet |
| prinomastat | WHO MedNet |
| prinomastat | WHO MedNet |
| prinomastatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| AG 3340 | ChemIDplus |
| AG-3340 | ChemIDplus |
| AG3340 | ChemIDplus |
| (S)-2,2-dimethyl-4-{[p-(4-pyridyloxy)phenyl]sulfonyl}-3-thiomorpholinecarbohydroxamic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:192329-42-3 | ChemIDplus |
| Citations |
|---|