EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16O |
| Net Charge | 0 |
| Average Mass | 116.204 |
| Monoisotopic Mass | 116.12012 |
| SMILES | CCCCC[C@H](C)O |
| InChI | InChI=1S/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | CETWDUZRCINIHU-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-heptanol (CHEBI:87378) has role metabolite (CHEBI:25212) |
| (2S)-2-heptanol (CHEBI:87378) is a heptan-2-ol (CHEBI:88815) |
| (2S)-2-heptanol (CHEBI:87378) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| (2S)-heptan-2-ol |
| Synonym | Source |
|---|---|
| (S)-2-hydroxyheptane | ChEBI |