EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16O |
| Net Charge | 0 |
| Average Mass | 116.204 |
| Monoisotopic Mass | 116.12012 |
| SMILES | CCCCCC(C)O |
| InChI | InChI=1S/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3 |
| InChIKey | CETWDUZRCINIHU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (36183375) | Strain: N-18 |
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (21970810) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptan-2-ol (CHEBI:88815) has role bacterial metabolite (CHEBI:76969) |
| heptan-2-ol (CHEBI:88815) has role plant metabolite (CHEBI:76924) |
| heptan-2-ol (CHEBI:88815) is a heptanol (CHEBI:195607) |
| heptan-2-ol (CHEBI:88815) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| (2S)-2-heptanol (CHEBI:87378) is a heptan-2-ol (CHEBI:88815) |
| IUPAC Name |
|---|
| heptan-2-ol |
| Synonyms | Source |
|---|---|
| 1-methylhexanol | ChEBI |
| 2-heptanol | ChEBI |
| 2-heptyl alcohol | ChEBI |
| 2-hydroxyheptane | ChEBI |
| amyl methyl carbinol | ChEBI |
| s-heptyl alcohol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2-Heptanol | Wikipedia |
| CPD-18994 | MetaCyc |
| HMDB0033908 | HMDB |
| LMFA05000615 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:543-49-7 | NIST Chemistry WebBook |
| Citations |
|---|