EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N2O6 |
| Net Charge | 0 |
| Average Mass | 346.339 |
| Monoisotopic Mass | 346.11649 |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O6/c1-9-13(16(20)24-3)15(14(10(2)18-9)17(21)25-4)11-7-5-6-8-12(11)19(22)23/h5-8,15,18H,1-4H3 |
| InChIKey | HYIMSNHJOBLJNT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | tocolytic agent Any compound used to suppress premature labour and immature birth by suppressing uterine contractions. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nifedipine (CHEBI:7565) has role calcium channel blocker (CHEBI:38215) |
| nifedipine (CHEBI:7565) has role human metabolite (CHEBI:77746) |
| nifedipine (CHEBI:7565) has role tocolytic agent (CHEBI:66993) |
| nifedipine (CHEBI:7565) has role vasodilator agent (CHEBI:35620) |
| nifedipine (CHEBI:7565) is a C-nitro compound (CHEBI:35716) |
| nifedipine (CHEBI:7565) is a dihydropyridine (CHEBI:50075) |
| nifedipine (CHEBI:7565) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| dimethyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| nifedipine | ChemIDplus |
| nifedipino | ChemIDplus |
| nifedipinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-(2'-Nitrophenyl)-2,6-dimethyl-1,4-dihydropyridin-3,5-dicarbonsäuredimethylester | ChemIDplus |
| Nifedipine | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Adalat | DrugBank |
| Adapine | DrugBank |
| Coracten | DrugBank |
| Nifecard | DrugBank |
| Nifecor | DrugBank |
| Nifedipres | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:497773 | Beilstein |
| CAS:21829-25-4 | NIST Chemistry WebBook |
| CAS:21829-25-4 | KEGG COMPOUND |
| CAS:21829-25-4 | ChemIDplus |