EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N2O6 |
| Net Charge | 0 |
| Average Mass | 346.339 |
| Monoisotopic Mass | 346.11649 |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O6/c1-9-13(16(20)24-3)15(14(10(2)18-9)17(21)25-4)11-7-5-6-8-12(11)19(22)23/h5-8,15,18H,1-4H3 |
| InChIKey | HYIMSNHJOBLJNT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. tocolytic agent Any compound used to suppress premature labour and immature birth by suppressing uterine contractions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nifedipine (CHEBI:7565) has role calcium channel blocker (CHEBI:38215) |
| nifedipine (CHEBI:7565) has role human metabolite (CHEBI:77746) |
| nifedipine (CHEBI:7565) has role tocolytic agent (CHEBI:66993) |
| nifedipine (CHEBI:7565) has role vasodilator agent (CHEBI:35620) |
| nifedipine (CHEBI:7565) is a C-nitro compound (CHEBI:35716) |
| nifedipine (CHEBI:7565) is a dihydropyridine (CHEBI:50075) |
| nifedipine (CHEBI:7565) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| dimethyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| nifedipinum | ChemIDplus |
| nifedipino | ChemIDplus |
| nifedipine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Nifedipine | KEGG COMPOUND |
| 4-(2'-Nitrophenyl)-2,6-dimethyl-1,4-dihydropyridin-3,5-dicarbonsäuredimethylester | ChemIDplus |
| Brand Names | Source |
|---|---|
| Adalat | DrugBank |
| Procardia | DrugBank |
| Adapine | DrugBank |
| Coracten | DrugBank |
| Nifedipres | DrugBank |
| Nifecor | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:497773 | Beilstein |
| CAS:21829-25-4 | KEGG COMPOUND |
| CAS:21829-25-4 | ChemIDplus |
| CAS:21829-25-4 | NIST Chemistry WebBook |