EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N2O6 |
| Net Charge | 0 |
| Average Mass | 346.339 |
| Monoisotopic Mass | 346.11649 |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O6/c1-9-13(16(20)24-3)15(14(10(2)18-9)17(21)25-4)11-7-5-6-8-12(11)19(22)23/h5-8,15,18H,1-4H3 |
| InChIKey | HYIMSNHJOBLJNT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. hypoglycemic agent A drug which lowers the blood glucose level. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. anticonvulsant A drug used to prevent seizures or reduce their severity. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. tocolytic agent Any compound used to suppress premature labour and immature birth by suppressing uterine contractions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nifedipine (CHEBI:7565) has role anticonvulsant (CHEBI:35623) |
| nifedipine (CHEBI:7565) has role antihypertensive agent (CHEBI:35674) |
| nifedipine (CHEBI:7565) has role antispasmodic drug (CHEBI:53784) |
| nifedipine (CHEBI:7565) has role calcium channel blocker (CHEBI:38215) |
| nifedipine (CHEBI:7565) has role cardiovascular drug (CHEBI:35554) |
| nifedipine (CHEBI:7565) has role human metabolite (CHEBI:77746) |
| nifedipine (CHEBI:7565) has role hypoglycemic agent (CHEBI:35526) |
| nifedipine (CHEBI:7565) has role nephroprotective agent (CHEBI:76595) |
| nifedipine (CHEBI:7565) has role tocolytic agent (CHEBI:66993) |
| nifedipine (CHEBI:7565) has role vasodilator agent (CHEBI:35620) |
| nifedipine (CHEBI:7565) is a C-nitro compound (CHEBI:35716) |
| nifedipine (CHEBI:7565) is a dihydropyridine (CHEBI:50075) |
| nifedipine (CHEBI:7565) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| dimethyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| nifedipine | ChemIDplus |
| nifedipino | ChemIDplus |
| nifedipinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-(2'-Nitrophenyl)-2,6-dimethyl-1,4-dihydropyridin-3,5-dicarbonsäuredimethylester | ChemIDplus |
| BAY A 1040 | ChEMBL |
| BAY-A-1040 | ChEMBL |
| Nifedipine | KEGG COMPOUND |
| Nifedipine hydrochloride | ChEMBL |
| Nifedipine slow release | ChEMBL |
| Brand Names | Source |
|---|---|
| Adalat | DrugBank |
| Adalat a.r. | ChEMBL |
| Adalat cc | ChEMBL |
| Adalate lp | ChEMBL |
| Adalat ic | ChEMBL |
| Adalat la 20 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:497773 | Beilstein |
| CAS:21829-25-4 | NIST Chemistry WebBook |
| CAS:21829-25-4 | ChemIDplus |
| CAS:21829-25-4 | KEGG COMPOUND |
| Citations |
|---|