EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75092 - morin
| Formula | C15H10O7 |
| Net Charge | 0 |
| Average Mass | 302.238 |
| Monoisotopic Mass | 302.04265 |
| SMILES | O=c1c(O)c(-c2ccc(O)cc2O)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,16-19,21H |
| InChIKey | YXOLAZRVSSWPPT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| morin (CHEBI:75092) has role angiogenesis modulating agent (CHEBI:50926) |
| morin (CHEBI:75092) has role anti-inflammatory agent (CHEBI:67079) |
| morin (CHEBI:75092) has role antibacterial agent (CHEBI:33282) |
| morin (CHEBI:75092) has role antihypertensive agent (CHEBI:35674) |
| morin (CHEBI:75092) has role antineoplastic agent (CHEBI:35610) |
| morin (CHEBI:75092) has role antioxidant (CHEBI:22586) |
| morin (CHEBI:75092) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| morin (CHEBI:75092) has role hepatoprotective agent (CHEBI:62868) |
| morin (CHEBI:75092) has role metabolite (CHEBI:25212) |
| morin (CHEBI:75092) has role neuroprotective agent (CHEBI:63726) |
| morin (CHEBI:75092) is a 7-hydroxyflavonol (CHEBI:52267) |
| morin (CHEBI:75092) is a pentahydroxyflavone (CHEBI:25883) |
| IUPAC Name |
|---|
| 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(2,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one | HMDB |
| 2',3,4',5,7-Pentahydroxyflavone | ChemIDplus |
| 2',4',3,5,7-Pentahydroxyflavone | ChemIDplus |
| 2',4',5,7-Tetrahydroxyflavan-3-ol | ChemIDplus |
| 2',4',5,7-Tetrahydroxyflavonol | HMDB |
| 3,5,7,2',4'-Pentahydroxyflavone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00004624 | KNApSAcK |
| C10105 | KEGG COMPOUND |
| HMDB0030796 | HMDB |
| LMPK12112517 | LIPID MAPS |
| LSM-36988 | LINCS |
| Morin_(flavonol) | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:327474 | Reaxys |
| CAS:480-16-0 | KEGG COMPOUND |
| CAS:480-16-0 | ChemIDplus |
| Citations |
|---|