EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O6 |
| Net Charge | 0 |
| Average Mass | 354.358 |
| Monoisotopic Mass | 354.11034 |
| SMILES | [H][C@]12CO[C@H](c3ccc4c(c3)OCO4)[C@@]1([H])CO[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H18O6/c1-3-15-17(25-9-23-15)5-11(1)19-13-7-22-20(14(13)8-21-19)12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2/t13-,14-,19+,20+/m0/s1 |
| InChIKey | PEYUIKBAABKQKQ-AFHBHXEDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cinnamomum camphora (ncbitaxon:13429) | stem (BTO:0001300) | Article (NAT PROD COMMUN, 2006, 1, 21) | |
| Hypericum chinense (IPNI:433315-1) | leaf (BTO:0000713) | PubMed (21043475) | 95% EtOH extract of dried, chopped leaves |
| Piper sarmentosum (ncbitaxon:405319) | |||
| leaf (BTO:0000713) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| stem (BTO:0001300) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| twig (BTO:0001411) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) | |
| inflorescence (BTO:0000628) | PubMed (21973101) | Chloroform soluble extract of aerial parts(leaves, twigs, stems, inflorescence) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-sesamin (CHEBI:66470) has role antineoplastic agent (CHEBI:35610) |
| (+)-sesamin (CHEBI:66470) has role neuroprotective agent (CHEBI:63726) |
| (+)-sesamin (CHEBI:66470) has role plant metabolite (CHEBI:76924) |
| (+)-sesamin (CHEBI:66470) is a benzodioxoles (CHEBI:38298) |
| (+)-sesamin (CHEBI:66470) is a furofuran (CHEBI:47790) |
| (+)-sesamin (CHEBI:66470) is a lignan (CHEBI:25036) |
| Incoming Relation(s) |
| (+)-sesamin dicatechol (CHEBI:136543) has functional parent (+)-sesamin (CHEBI:66470) |
| (+)-sesamin monocatechol (CHEBI:136542) has functional parent (+)-sesamin (CHEBI:66470) |
| IUPAC Name |
|---|
| 5,5'-(1S,3aR,4S,6aR)-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole) |
| Synonyms | Source |
|---|---|
| Fagarol | ChemIDplus |
| Sezamin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (+)-sesamin | UniProt |
| Citations |
|---|