EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O6 |
| Net Charge | 0 |
| Average Mass | 330.336 |
| Monoisotopic Mass | 330.11034 |
| SMILES | [H][C@]12CO[C@]([H])(c3ccc(O)c(O)c3)[C@@]1([H])CO[C@]2([H])c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H18O6/c19-13-3-1-9(5-15(13)21)17-11-7-24-18(12(11)8-23-17)10-2-4-14(20)16(22)6-10/h1-6,11-12,17-22H,7-8H2/t11-,12-,17+,18+/m0/s1 |
| InChIKey | OQSOTSIYXPYTRE-YDOWWZDFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morinda citrifolia (ncbitaxon:43522) | - | PubMed (24224843) | Methanol extract |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-sesamin dicatechol (CHEBI:136543) has functional parent (+)-sesamin (CHEBI:66470) |
| (+)-sesamin dicatechol (CHEBI:136543) has functional parent (+)-sesamin monocatechol (CHEBI:136542) |
| (+)-sesamin dicatechol (CHEBI:136543) has role plant metabolite (CHEBI:76924) |
| (+)-sesamin dicatechol (CHEBI:136543) is a catechols (CHEBI:33566) |
| (+)-sesamin dicatechol (CHEBI:136543) is a furofuran (CHEBI:47790) |
| (+)-sesamin dicatechol (CHEBI:136543) is a lignan (CHEBI:25036) |
| IUPAC Name |
|---|
| 4-[(1S,3aR,4S,6aR)-4-(3,4-dihydroxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]benzene-1,2-diol |
| Synonym | Source |
|---|---|
| SC-2 | ChEBI |
| UniProt Name | Source |
|---|---|
| (+)-sesamin dicatechol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9658635 | Reaxys |
| Citations |
|---|