EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N6S |
| Net Charge | 0 |
| Average Mass | 252.347 |
| Monoisotopic Mass | 252.11572 |
| SMILES | CN/C(=N/C#N)NCCSCc1ncnc1C |
| InChI | InChI=1S/C10H16N6S/c1-8-9(16-7-15-8)5-17-4-3-13-10(12-2)14-6-11/h7H,3-5H2,1-2H3,(H,15,16)(H2,12,13,14) |
| InChIKey | AQIXAKUUQRKLND-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | adjuvant Any pharmacological or immunological agent that modifies the effect of other agents such as drugs or vaccines while having few if any direct effects when given by itself. H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cimetidine (CHEBI:3699) has role adjuvant (CHEBI:60809) |
| cimetidine (CHEBI:3699) has role analgesic (CHEBI:35480) |
| cimetidine (CHEBI:3699) has role anti-ulcer drug (CHEBI:49201) |
| cimetidine (CHEBI:3699) has role H2-receptor antagonist (CHEBI:37961) |
| cimetidine (CHEBI:3699) has role P450 inhibitor (CHEBI:50183) |
| cimetidine (CHEBI:3699) is a aliphatic sulfide (CHEBI:22327) |
| cimetidine (CHEBI:3699) is a guanidines (CHEBI:24436) |
| cimetidine (CHEBI:3699) is a imidazoles (CHEBI:24780) |
| cimetidine (CHEBI:3699) is a nitrile (CHEBI:18379) |
| Incoming Relation(s) |
| cimetidine S-oxide (CHEBI:30731) has functional parent cimetidine (CHEBI:3699) |
| cimetidine hydrochloride (CHEBI:50362) has part cimetidine (CHEBI:3699) |
| IUPAC Name |
|---|
| 2-cyano-1-methyl-3-(2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethyl)guanidine |
| INNs | Source |
|---|---|
| cimetidina | ChemIDplus |
| cimetidine | ChemIDplus |
| cimétidine | ChEBI |
| cimetidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-Cyano-2-methyl-3-(2-(((5-methyl-4-imidazolyl)methyl)thio)ethyl)guanidine | ChemIDplus |
| 2-cyano-1-methyl-3-(2-(((5-methylimidazol-4-yl)methyl)thio)ethyl)guanidine | NIST Chemistry WebBook |
| N-cyano-N'-methyl-N''-(2-([(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl)ethyl)guanidine | NIST Chemistry WebBook |
| N''-cyano-N-methyl-N'-(2-{[(5-methyl-1H-imidazol-4-yl)methyl]thio}ethyl)guanidine | ChEBI |
| Brand Names | Source |
|---|---|
| Cimetag | DrugBank |
| Tagamet HB 200 | DrugBank |
| Ulcerfen | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1892 | VSDB |
| 645 | DrugCentral |
| BE804144 | Patent |
| Cimetidine | Wikipedia |
| D00295 | KEGG DRUG |
| DB00501 | DrugBank |
| HMDB0014644 | HMDB |
| LSM-2404 | LINCS |
| US3950333 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6516325 | Reaxys |
| CAS:51481-61-9 | NIST Chemistry WebBook |
| CAS:51481-61-9 | KEGG COMPOUND |
| CAS:51481-61-9 | ChemIDplus |
| Citations |
|---|