EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C10H16N6S.Cl |
| Net Charge | 0 |
| Average Mass | 288.808 |
| Monoisotopic Mass | 288.09239 |
| SMILES | CN/C(=N/C#N)NCCSCc1ncnc1C.[Cl-].[H+] |
| InChI | InChI=1S/C10H16N6S.ClH/c1-8-9(16-7-15-8)5-17-4-3-13-10(12-2)14-6-11;/h7H,3-5H2,1-2H3,(H,15,16)(H2,12,13,14);1H |
| InChIKey | QJHCNBWLPSXHBL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cimetidine hydrochloride (CHEBI:50362) has part cimetidine (CHEBI:3699) |
| cimetidine hydrochloride (CHEBI:50362) has role anti-ulcer drug (CHEBI:49201) |
| cimetidine hydrochloride (CHEBI:50362) is a hydrochloride (CHEBI:36807) |
| Synonym | Source |
|---|---|
| Cimetidine HCl | ChemIDplus |
| Brand Name | Source |
|---|---|
| Tagamet | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:70059-30-2 | ChemIDplus |