EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O |
| Net Charge | 0 |
| Average Mass | 220.356 |
| Monoisotopic Mass | 220.18272 |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h8-9,16H,1-7H3 |
| InChIKey | NLZUEZXRPGMBCV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (1268322) |
| Roles Classification |
|---|
| Chemical Roles: | food additive Any substance which is added to food to preserve or enhance its flavour and/or appearance. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | food additive Any substance which is added to food to preserve or enhance its flavour and/or appearance. ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Applications: | food additive Any substance which is added to food to preserve or enhance its flavour and/or appearance. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) has functional parent phenol (CHEBI:15882) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) has role antioxidant (CHEBI:22586) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) has role ferroptosis inhibitor (CHEBI:173084) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) has role food additive (CHEBI:64047) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) has role geroprotector (CHEBI:176497) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,6-di-tert-butyl-4-methylphenol |
| Synonyms | Source |
|---|---|
| 1-hydroxy-4-methyl-2,6-di-tert-butylbenzene | ChemIDplus |
| 2,6-bis(1,1-dimethylethyl)-4-methylphenol | KEGG COMPOUND |
| 2,6-di-t-butyl-4-methylphenol | KEGG COMPOUND |
| 2,6-di-t-butyl-p-cresol | ChemIDplus |
| 2,6-di-tert-butyl-1-hydroxy-4-methylbenzene | ChemIDplus |
| 2,6-di-tert-butyl-4-cresol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 13835296 | ChemSpider |
| Butylated_hydroxytoluene | Wikipedia |
| C14693 | KEGG COMPOUND |
| D02413 | KEGG DRUG |
| FDB011992 | FooDB |
| HMDB0033826 | HMDB |
| LSM-19020 | LINCS |
| Citations |
|---|