EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O |
| Net Charge | 0 |
| Average Mass | 220.356 |
| Monoisotopic Mass | 220.18272 |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h8-9,16H,1-7H3 |
| InChIKey | NLZUEZXRPGMBCV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (1268322) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. food additive Any substance which is added to food to preserve or enhance its flavour and/or appearance. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. food additive Any substance which is added to food to preserve or enhance its flavour and/or appearance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) has functional parent phenol (CHEBI:15882) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) has role antioxidant (CHEBI:22586) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) has role ferroptosis inhibitor (CHEBI:173084) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) has role food additive (CHEBI:64047) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) has role geroprotector (CHEBI:176497) |
| 2,6-di-tert-butyl-4-methylphenol (CHEBI:34247) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,6-di-tert-butyl-4-methylphenol |
| Synonyms | Source |
|---|---|
| 1-hydroxy-4-methyl-2,6-di-tert-butylbenzene | ChemIDplus |
| 2,6-bis(1,1-dimethylethyl)-4-methylphenol | KEGG COMPOUND |
| 2,6-di-t-butyl-4-methylphenol | KEGG COMPOUND |
| 2,6-di-t-butyl-p-cresol | ChemIDplus |
| 2,6-di-tert-butyl-1-hydroxy-4-methylbenzene | ChemIDplus |
| 2,6-di-tert-butyl-4-cresol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 13835296 | ChemSpider |
| Butylated_hydroxytoluene | Wikipedia |
| C14693 | KEGG COMPOUND |
| D02413 | KEGG DRUG |
| FDB011992 | FooDB |
| HMDB0033826 | HMDB |
| LSM-19020 | LINCS |
| Citations |
|---|