EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32047 - premithramycin A2'
| Formula | C33H38O15 |
| Net Charge | 0 |
| Average Mass | 674.652 |
| Monoisotopic Mass | 674.22107 |
| SMILES | [H][C@@]12Cc3cc4cc(O)cc(O)c4c(O)c3C(=O)[C@]1(O[C@H]1C[C@@H](O[C@H]3C[C@@H](O)[C@@H](O)[C@@H](C)O3)[C@H](O)[C@@H](C)O1)C(=O)C(C(C)=O)=C(O)[C@H]2OC |
| InChI | InChI=1S/C33H38O15/c1-11(34)23-29(41)30(44-4)17-7-15-5-14-6-16(35)8-18(36)24(14)28(40)25(15)32(43)33(17,31(23)42)48-22-10-20(27(39)13(3)46-22)47-21-9-19(37)26(38)12(2)45-21/h5-6,8,12-13,17,19-22,26-27,30,35-41H,7,9-10H2,1-4H3/t12-,13-,17+,19-,20-,21+,22+,26+,27-,30+,33-/m1/s1 |
| InChIKey | FANJWAKCIVIYMP-JYVXNHNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces argillaceus (ncbitaxon:41951) | - | PubMed (10652287) | Strain: ATCC 12596 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| premithramycin A2' (CHEBI:32047) has role bacterial metabolite (CHEBI:76969) |
| premithramycin A2' (CHEBI:32047) is a aromatic ketone (CHEBI:76224) |
| premithramycin A2' (CHEBI:32047) is a cyclic ketone (CHEBI:3992) |
| premithramycin A2' (CHEBI:32047) is a disaccharide derivative (CHEBI:63353) |
| premithramycin A2' (CHEBI:32047) is a enol (CHEBI:33823) |
| premithramycin A2' (CHEBI:32047) is a enone (CHEBI:51689) |
| premithramycin A2' (CHEBI:32047) is a ether (CHEBI:25698) |
| premithramycin A2' (CHEBI:32047) is a polyphenol (CHEBI:26195) |
| premithramycin A2' (CHEBI:32047) is a tetracenomycin (CHEBI:48132) |
| IUPAC Name |
|---|
| (1S,4aS,12aS)-3-acetyl-2,6,7,9-tetrahydroxy-1-methoxy-4,5-dioxo-1,5,12,12a-tetrahydrotetracen-4a(4H)-yl 2,6-dideoxy-β-D-lyxo-hexopyranosyl-(1→3)-2,6-dideoxy-β-D-arabino-hexopyranoside |
| Synonym | Source |
|---|---|
| premithramycin A2 | MetaCyc |
| Citations |
|---|