EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32047 - premithramycin A2'
| Formula | C33H38O15 |
| Net Charge | 0 |
| Average Mass | 674.652 |
| Monoisotopic Mass | 674.22107 |
| SMILES | [H][C@@]12Cc3cc4cc(O)cc(O)c4c(O)c3C(=O)[C@]1(O[C@H]1C[C@@H](O[C@H]3C[C@@H](O)[C@@H](O)[C@@H](C)O3)[C@H](O)[C@@H](C)O1)C(=O)C(C(C)=O)=C(O)[C@H]2OC |
| InChI | InChI=1S/C33H38O15/c1-11(34)23-29(41)30(44-4)17-7-15-5-14-6-16(35)8-18(36)24(14)28(40)25(15)32(43)33(17,31(23)42)48-22-10-20(27(39)13(3)46-22)47-21-9-19(37)26(38)12(2)45-21/h5-6,8,12-13,17,19-22,26-27,30,35-41H,7,9-10H2,1-4H3/t12-,13-,17+,19-,20-,21+,22+,26+,27-,30+,33-/m1/s1 |
| InChIKey | FANJWAKCIVIYMP-JYVXNHNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces argillaceus (ncbitaxon:41951) | - | PubMed (10652287) | Strain: ATCC 12596 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| premithramycin A2' (CHEBI:32047) has role bacterial metabolite (CHEBI:76969) |
| premithramycin A2' (CHEBI:32047) is a aromatic ketone (CHEBI:76224) |
| premithramycin A2' (CHEBI:32047) is a cyclic ketone (CHEBI:3992) |
| premithramycin A2' (CHEBI:32047) is a disaccharide derivative (CHEBI:63353) |
| premithramycin A2' (CHEBI:32047) is a enol (CHEBI:33823) |
| premithramycin A2' (CHEBI:32047) is a enone (CHEBI:51689) |
| premithramycin A2' (CHEBI:32047) is a ether (CHEBI:25698) |
| premithramycin A2' (CHEBI:32047) is a polyphenol (CHEBI:26195) |
| premithramycin A2' (CHEBI:32047) is a tetracenomycin (CHEBI:48132) |
| IUPAC Name |
|---|
| (1S,4aS,12aS)-3-acetyl-2,6,7,9-tetrahydroxy-1-methoxy-4,5-dioxo-1,5,12,12a-tetrahydrotetracen-4a(4H)-yl 2,6-dideoxy-β-D-lyxo-hexopyranosyl-(1→3)-2,6-dideoxy-β-D-arabino-hexopyranoside |
| Synonym | Source |
|---|---|
| premithramycin A2 | MetaCyc |
| Citations |
|---|