EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2S2 |
| Net Charge | 0 |
| Average Mass | 153.228 |
| Monoisotopic Mass | 152.99182 |
| SMILES | N[C@@H](CSS)C(=O)O |
| InChI | InChI=1S/C3H7NO2S2/c4-2(1-8-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
| InChIKey | XBKONSCREBSMCS-REOHCLBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-disulfanyl-L-alanine (CHEBI:28839) has role human metabolite (CHEBI:77746) |
| 3-disulfanyl-L-alanine (CHEBI:28839) has role mouse metabolite (CHEBI:75771) |
| 3-disulfanyl-L-alanine (CHEBI:28839) is a S-substituted L-cysteine (CHEBI:47910) |
| 3-disulfanyl-L-alanine (CHEBI:28839) is tautomer of 3-disulfanyl-L-alanine zwitterion (CHEBI:58591) |
| Incoming Relation(s) |
| 3-disulfanyl-L-alanine residue (CHEBI:61963) is substituent group from 3-disulfanyl-L-alanine (CHEBI:28839) |
| 3-disulfanyl-L-alanine zwitterion (CHEBI:58591) is tautomer of 3-disulfanyl-L-alanine (CHEBI:28839) |
| IUPAC Name |
|---|
| 3-disulfanyl-L-alanine |
| Synonyms | Source |
|---|---|
| 2-amino-3-disulfanylpropanoic acid | RESID |
| 2-amino-3-hydrodisulfidopropanoic acid | RESID |
| 2-amino-3-hydropersulfidopropanoic acid | RESID |
| 2-amino-3-persulfhydrylpropanoic acid | RESID |
| 3-(thiosulfeno)-alanine | RESID |
| cysteine persulfide | ChEBI |
| Citations |
|---|